C21H19ClF3N3O2S — CID 118625213
tert-butyl 4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-6-(trifluoromethyl)phenyl]benzoate (PubChem CID 118625213) has the molecular formula C21H19ClF3N3O2S and a molecular weight of 469.92 g/mol. Its IUPAC name is tert-butyl 4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-6-(trifluoromethyl)phenyl]benzoate.
| Compound Name | tert-butyl 4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-6-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 118625213 |
| Molecular Formula | C21H19ClF3N3O2S |
| Molecular Weight | 469.92 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | tert-butyl 4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-6-(trifluoromethyl)phenyl]benzoate |
| SMILES | CS/C(=N\c1cc(Cl)c(-c2ccc(C(=O)OC(C)(C)C)cc2)c(C(F)(F)F)c1)NC#N |
| InChI | InChI=1S/C21H19ClF3N3O2S/c1-20(2,3)30-18(29)13-7-5-12(6-8-13)17-15(21(23,24)25)9-14(10-16(17)22)28-19(31-4)27-11-26/h5-10H,1-4H3,(H,27,28) |
| InChIKey | TWDQTJJFTSDAGJ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.92 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|