C27H30ClF3N4O4S2 — CID 158895560
tert-butyl 2-[2-[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylethyl]pyrrolidine-1-carboxylate (PubChem CID 158895560) has the molecular formula C27H30ClF3N4O4S2 and a molecular weight of 631.14 g/mol. Its IUPAC name is tert-butyl 2-[2-[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 158895560 |
| Molecular Formula | C27H30ClF3N4O4S2 |
| Molecular Weight | 631.14 g/mol |
| Exact Mass | 630.13 |
| IUPAC Name | tert-butyl 2-[2-[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylethyl]pyrrolidine-1-carboxylate |
| SMILES | CS/C(=N\c1cc(Cl)c(-c2ccc(S(=O)(=O)CCC3CCCN3C(=O)OC(C)(C)C)cc2)c(C(F)(F)F)c1)NC#N |
| InChI | InChI=1S/C27H30ClF3N4O4S2/c1-26(2,3)39-25(36)35-12-5-6-19(35)11-13-41(37,38)20-9-7-17(8-10-20)23-21(27(29,30)31)14-18(15-22(23)28)34-24(40-4)33-16-32/h7-10,14-15,19H,5-6,11-13H2,1-4H3,(H,33,34) |
| InChIKey | JEUCANMYDRPEJQ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.14 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|