C23H29BrN2O2 — CID 160674172
tert-butyl 2-[2-[4-(4-bromophenyl)anilino]ethyl]pyrrolidine-1-carboxylate (PubChem CID 160674172) has the molecular formula C23H29BrN2O2 and a molecular weight of 445.40 g/mol. Its IUPAC name is tert-butyl 2-[2-[4-(4-bromophenyl)anilino]ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[4-(4-bromophenyl)anilino]ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 160674172 |
| Molecular Formula | C23H29BrN2O2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | tert-butyl 2-[2-[4-(4-bromophenyl)anilino]ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1CCNc1ccc(-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H29BrN2O2/c1-23(2,3)28-22(27)26-16-4-5-21(26)14-15-25-20-12-8-18(9-13-20)17-6-10-19(24)11-7-17/h6-13,21,25H,4-5,14-16H2,1-3H3 |
| InChIKey | MISWGROOFFVTFJ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |