C20H31FN2O2 — CID 176701380
tert-butyl 2-[2-(5-fluoro-2-propan-2-ylanilino)ethyl]pyrrolidine-1-carboxylate (PubChem CID 176701380) has the molecular formula C20H31FN2O2 and a molecular weight of 350.48 g/mol. Its IUPAC name is tert-butyl 2-[2-(5-fluoro-2-propan-2-ylanilino)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(5-fluoro-2-propan-2-ylanilino)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 176701380 |
| Molecular Formula | C20H31FN2O2 |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | tert-butyl 2-[2-(5-fluoro-2-propan-2-ylanilino)ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)c1ccc(F)cc1NCCC1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31FN2O2/c1-14(2)17-9-8-15(21)13-18(17)22-11-10-16-7-6-12-23(16)19(24)25-20(3,4)5/h8-9,13-14,16,22H,6-7,10-12H2,1-5H3 |
| InChIKey | RUQJUKOWDVWCFY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |