C20H29FN2O4 — CID 124889172
tert-butyl (2R)-2-[3-[2-(3-fluorophenoxy)ethylamino]-3-oxopropyl]pyrrolidine-1-carboxylate (PubChem CID 124889172) has the molecular formula C20H29FN2O4 and a molecular weight of 380.46 g/mol. Its IUPAC name is tert-butyl (2R)-2-[3-[2-(3-fluorophenoxy)ethylamino]-3-oxopropyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[3-[2-(3-fluorophenoxy)ethylamino]-3-oxopropyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 124889172 |
| Molecular Formula | C20H29FN2O4 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | tert-butyl (2R)-2-[3-[2-(3-fluorophenoxy)ethylamino]-3-oxopropyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1CCC(=O)NCCOc1cccc(F)c1 |
| InChI | InChI=1S/C20H29FN2O4/c1-20(2,3)27-19(25)23-12-5-7-16(23)9-10-18(24)22-11-13-26-17-8-4-6-15(21)14-17/h4,6,8,14,16H,5,7,9-13H2,1-3H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | HGALYPUMBTXOJJ-MRXNPFEDSA-N |
| XLogP | 3.50 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|