C20H30FNO3 — CID 114239643
tert-butyl 2-[2-(3-fluorophenyl)-2-hydroxyethyl]azocane-1-carboxylate (PubChem CID 114239643) has the molecular formula C20H30FNO3 and a molecular weight of 351.46 g/mol. Its IUPAC name is tert-butyl 2-[2-(3-fluorophenyl)-2-hydroxyethyl]azocane-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(3-fluorophenyl)-2-hydroxyethyl]azocane-1-carboxylate |
|---|---|
| PubChem CID | 114239643 |
| Molecular Formula | C20H30FNO3 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | tert-butyl 2-[2-(3-fluorophenyl)-2-hydroxyethyl]azocane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCCCC1CC(O)c1cccc(F)c1 |
| InChI | InChI=1S/C20H30FNO3/c1-20(2,3)25-19(24)22-12-7-5-4-6-11-17(22)14-18(23)15-9-8-10-16(21)13-15/h8-10,13,17-18,23H,4-7,11-12,14H2,1-3H3 |
| InChIKey | YYDHVZOSGPKPCT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |