About tert-butyl 2-(2-ethoxy-1-hydroxy-2-oxoethyl)pyrrolidine-1-carboxylate;1,3-difluorobenzene
tert-butyl 2-(2-ethoxy-1-hydroxy-2-oxoethyl)pyrrolidine-1-carboxylate;1,3-difluorobenzene (PubChem CID 142310462) has the molecular formula C19H27F2NO5
and a molecular weight of 387.42 g/mol. Its IUPAC name is tert-butyl 2-(2-ethoxy-1-hydroxy-2-oxoethyl)pyrrolidine-1-carboxylate;1,3-difluorobenzene.
Molecular Properties
| Compound Name | tert-butyl 2-(2-ethoxy-1-hydroxy-2-oxoethyl)pyrrolidine-1-carboxylate;1,3-difluorobenzene |
| PubChem CID | 142310462 |
| Molecular Formula | C19H27F2NO5 |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | tert-butyl 2-(2-ethoxy-1-hydroxy-2-oxoethyl)pyrrolidine-1-carboxylate;1,3-difluorobenzene |
| SMILES | CCOC(=O)C(O)C1CCCN1C(=O)OC(C)(C)C.Fc1cccc(F)c1 |
| InChI | InChI=1S/C13H23NO5.C6H4F2/c1-5-18-11(16)10(15)9-7-6-8-14(9)12(17)19-13(2,3)4;7-5-2-1-3-6(8)4-5/h9-10,15H,5-8H2,1-4H3;1-4H |
| InChIKey | KQQGBPPTEFSKDU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-(2-ethoxy-1-hydroxy-2-oxoethyl)pyrrolidine-1-carboxylate;1,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(2-ethoxy-1-hydroxy-2-oxoethyl)pyrrolidine-1-carboxylate;1,3-difluorobenzene?
The IUPAC name of tert-butyl 2-(2-ethoxy-1-hydroxy-2-oxoethyl)pyrrolidine-1-carboxylate;1,3-difluorobenzene (CID 142310462) is tert-butyl 2-(2-ethoxy-1-hydroxy-2-oxoethyl)pyrrolidine-1-carboxylate;1,3-difluorobenzene.
What is the SMILES notation for tert-butyl 2-(2-ethoxy-1-hydroxy-2-oxoethyl)pyrrolidine-1-carboxylate;1,3-difluorobenzene?
The canonical SMILES for tert-butyl 2-(2-ethoxy-1-hydroxy-2-oxoethyl)pyrrolidine-1-carboxylate;1,3-difluorobenzene is CCOC(=O)C(O)C1CCCN1C(=O)OC(C)(C)C.Fc1cccc(F)c1.
What is the InChIKey of tert-butyl 2-(2-ethoxy-1-hydroxy-2-oxoethyl)pyrrolidine-1-carboxylate;1,3-difluorobenzene?
The InChIKey is KQQGBPPTEFSKDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO5.C6H4F2/c1-5-18-11(16)10(15)9-7-6-8-14(9)12(17)19-13(2,3)4;7-5-2-1-3-6(8)4-5/h9-10,15H,5-8H2,1-4H3;1-4H.
What are the key properties of tert-butyl 2-(2-ethoxy-1-hydroxy-2-oxoethyl)pyrrolidine-1-carboxylate;1,3-difluorobenzene?
tert-butyl 2-(2-ethoxy-1-hydroxy-2-oxoethyl)pyrrolidine-1-carboxylate;1,3-difluorobenzene has a molecular weight of 387.42 g/mol, XLogP of 3.27, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(2-ethoxy-1-hydroxy-2-oxoethyl)pyrrolidine-1-carboxylate;1,3-difluorobenzene is sourced from PubChem (CID 142310462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).