C21H31FN2O2 — CID 72651225
tert-butyl 2-[2-[[3-(4-fluorophenyl)-2-methylprop-2-enyl]amino]ethyl]pyrrolidine-1-carboxylate (PubChem CID 72651225) has the molecular formula C21H31FN2O2 and a molecular weight of 362.49 g/mol. Its IUPAC name is tert-butyl 2-[2-[[3-(4-fluorophenyl)-2-methylprop-2-enyl]amino]ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[[3-(4-fluorophenyl)-2-methylprop-2-enyl]amino]ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 72651225 |
| Molecular Formula | C21H31FN2O2 |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | tert-butyl 2-[2-[[3-(4-fluorophenyl)-2-methylprop-2-enyl]amino]ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(=Cc1ccc(F)cc1)CNCCC1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31FN2O2/c1-16(14-17-7-9-18(22)10-8-17)15-23-12-11-19-6-5-13-24(19)20(25)26-21(2,3)4/h7-10,14,19,23H,5-6,11-13,15H2,1-4H3 |
| InChIKey | HFHPENCSIZJYDV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|