C21H32N2O2 — CID 72524883
tert-butyl 2-[2-[(2-methyl-3-phenylprop-2-enyl)amino]ethyl]pyrrolidine-1-carboxylate (PubChem CID 72524883) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is tert-butyl 2-[2-[(2-methyl-3-phenylprop-2-enyl)amino]ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[(2-methyl-3-phenylprop-2-enyl)amino]ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 72524883 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | tert-butyl 2-[2-[(2-methyl-3-phenylprop-2-enyl)amino]ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(=Cc1ccccc1)CNCCC1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32N2O2/c1-17(15-18-9-6-5-7-10-18)16-22-13-12-19-11-8-14-23(19)20(24)25-21(2,3)4/h5-7,9-10,15,19,22H,8,11-14,16H2,1-4H3 |
| InChIKey | LIHDRMSUFCOEBA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|