C11H8Cl2F3N3OS — CID 169363676
methyl N'-[4-chloro-3-(2-chloro-1,1,2-trifluoroethoxy)phenyl]-N-cyanocarbamimidothioate (PubChem CID 169363676) has the molecular formula C11H8Cl2F3N3OS and a molecular weight of 358.17 g/mol. Its IUPAC name is methyl N'-[4-chloro-3-(2-chloro-1,1,2-trifluoroethoxy)phenyl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-[4-chloro-3-(2-chloro-1,1,2-trifluoroethoxy)phenyl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169363676 |
| Molecular Formula | C11H8Cl2F3N3OS |
| Molecular Weight | 358.17 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | methyl N'-[4-chloro-3-(2-chloro-1,1,2-trifluoroethoxy)phenyl]-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1ccc(Cl)c(OC(F)(F)C(F)Cl)c1)NC#N |
| InChI | InChI=1S/C11H8Cl2F3N3OS/c1-21-10(18-5-17)19-6-2-3-7(12)8(4-6)20-11(15,16)9(13)14/h2-4,9H,1H3,(H,18,19) |
| InChIKey | RKAWINXGHMBBKE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.17 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|