C11H9F4N3OS — CID 169362629
methyl N-cyano-N'-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamimidothioate (PubChem CID 169362629) has the molecular formula C11H9F4N3OS and a molecular weight of 307.27 g/mol. Its IUPAC name is methyl N-cyano-N'-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169362629 |
| Molecular Formula | C11H9F4N3OS |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | methyl N-cyano-N'-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1ccccc1OC(F)(F)C(F)F)NC#N |
| InChI | InChI=1S/C11H9F4N3OS/c1-20-10(17-6-16)18-7-4-2-3-5-8(7)19-11(14,15)9(12)13/h2-5,9H,1H3,(H,17,18) |
| InChIKey | MEXCVXFXADUHKP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|