C10H8BrF2N3OS — CID 169361269
methyl N'-[4-bromo-2-(difluoromethoxy)phenyl]-N-cyanocarbamimidothioate (PubChem CID 169361269) has the molecular formula C10H8BrF2N3OS and a molecular weight of 336.16 g/mol. Its IUPAC name is methyl N'-[4-bromo-2-(difluoromethoxy)phenyl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-[4-bromo-2-(difluoromethoxy)phenyl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169361269 |
| Molecular Formula | C10H8BrF2N3OS |
| Molecular Weight | 336.16 g/mol |
| Exact Mass | 334.95 |
| IUPAC Name | methyl N'-[4-bromo-2-(difluoromethoxy)phenyl]-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1ccc(Br)cc1OC(F)F)NC#N |
| InChI | InChI=1S/C10H8BrF2N3OS/c1-18-10(15-5-14)16-7-3-2-6(11)4-8(7)17-9(12)13/h2-4,9H,1H3,(H,15,16) |
| InChIKey | IMCKOTDWZODLOF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.16 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|