C16H16N4O2S2 — CID 169362380
methyl N-cyano-N'-[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamimidothioate (PubChem CID 169362380) has the molecular formula C16H16N4O2S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is methyl N-cyano-N'-[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169362380 |
| Molecular Formula | C16H16N4O2S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | methyl N-cyano-N'-[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1ccc(NS(=O)(=O)c2ccc(C)cc2)cc1)NC#N |
| InChI | InChI=1S/C16H16N4O2S2/c1-12-3-9-15(10-4-12)24(21,22)20-14-7-5-13(6-8-14)19-16(23-2)18-11-17/h3-10,20H,1-2H3,(H,18,19) |
| InChIKey | IPXHEZLJJIMOGV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|