C15H13N5O4S2 — CID 169364205
methyl N-cyano-N'-[4-[(1-oxidopyridin-1-ium-3-carbonyl)sulfamoyl]phenyl]carbamimidothioate (PubChem CID 169364205) has the molecular formula C15H13N5O4S2 and a molecular weight of 391.43 g/mol. Its IUPAC name is methyl N-cyano-N'-[4-[(1-oxidopyridin-1-ium-3-carbonyl)sulfamoyl]phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[4-[(1-oxidopyridin-1-ium-3-carbonyl)sulfamoyl]phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169364205 |
| Molecular Formula | C15H13N5O4S2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | methyl N-cyano-N'-[4-[(1-oxidopyridin-1-ium-3-carbonyl)sulfamoyl]phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1ccc(S(=O)(=O)NC(=O)c2ccc[n+]([O-])c2)cc1)NC#N |
| InChI | InChI=1S/C15H13N5O4S2/c1-25-15(17-10-16)18-12-4-6-13(7-5-12)26(23,24)19-14(21)11-3-2-8-20(22)9-11/h2-9H,1H3,(H,17,18)(H,19,21) |
| InChIKey | GPGSWPHGIDYCCS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|