C17H14N2O5S-2 — CID 4748967
4-[4-[(4-methylphenyl)sulfonylamino]phenyl]imino-4-oxidobut-2-enoate (PubChem CID 4748967) has the molecular formula C17H14N2O5S-2 and a molecular weight of 358.38 g/mol. Its IUPAC name is 4-[4-[(4-methylphenyl)sulfonylamino]phenyl]imino-4-oxidobut-2-enoate.
| Compound Name | 4-[4-[(4-methylphenyl)sulfonylamino]phenyl]imino-4-oxidobut-2-enoate |
|---|---|
| PubChem CID | 4748967 |
| Molecular Formula | C17H14N2O5S-2 |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 4-[4-[(4-methylphenyl)sulfonylamino]phenyl]imino-4-oxidobut-2-enoate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(/N=C(\[O-])C=CC(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C17H16N2O5S/c1-12-2-8-15(9-3-12)25(23,24)19-14-6-4-13(5-7-14)18-16(20)10-11-17(21)22/h2-11,19H,1H3,(H,18,20)(H,21,22)/p-2 |
| InChIKey | VZHMJEMUGJULJE-UHFFFAOYSA-L |
| XLogP | 0.49 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|