C14H13N2O3S- — CID 4744543
4-[(4-methylphenyl)sulfonylamino]benzenecarboximidate (PubChem CID 4744543) has the molecular formula C14H13N2O3S- and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-[(4-methylphenyl)sulfonylamino]benzenecarboximidate.
| Compound Name | 4-[(4-methylphenyl)sulfonylamino]benzenecarboximidate |
|---|---|
| PubChem CID | 4744543 |
| Molecular Formula | C14H13N2O3S- |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 4-[(4-methylphenyl)sulfonylamino]benzenecarboximidate |
| SMILES | [H]/N=C(\[O-])c1ccc(NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C14H14N2O3S/c1-10-2-8-13(9-3-10)20(18,19)16-12-6-4-11(5-7-12)14(15)17/h2-9,16H,1H3,(H2,15,17)/p-1 |
| InChIKey | OEPGVBWEPKWNEP-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|