About methyl N-(4-cyanophenyl)-N'-(4-methylphenyl)carbamimidothioate
methyl N-(4-cyanophenyl)-N'-(4-methylphenyl)carbamimidothioate (PubChem CID 19855134) has the molecular formula C16H15N3S
and a molecular weight of 281.38 g/mol. Its IUPAC name is methyl N-(4-cyanophenyl)-N'-(4-methylphenyl)carbamimidothioate.
Molecular Properties
| Compound Name | methyl N-(4-cyanophenyl)-N'-(4-methylphenyl)carbamimidothioate |
| PubChem CID | 19855134 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | methyl N-(4-cyanophenyl)-N'-(4-methylphenyl)carbamimidothioate |
| SMILES | CS/C(=N\c1ccc(C)cc1)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H15N3S/c1-12-3-7-14(8-4-12)18-16(20-2)19-15-9-5-13(11-17)6-10-15/h3-10H,1-2H3,(H,18,19) |
| InChIKey | LSMWFCZHYQTLBV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(4-cyanophenyl)-N'-(4-methylphenyl)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(4-cyanophenyl)-N'-(4-methylphenyl)carbamimidothioate?
The IUPAC name of methyl N-(4-cyanophenyl)-N'-(4-methylphenyl)carbamimidothioate (CID 19855134) is methyl N-(4-cyanophenyl)-N'-(4-methylphenyl)carbamimidothioate.
What is the SMILES notation for methyl N-(4-cyanophenyl)-N'-(4-methylphenyl)carbamimidothioate?
The canonical SMILES for methyl N-(4-cyanophenyl)-N'-(4-methylphenyl)carbamimidothioate is CS/C(=N\c1ccc(C)cc1)Nc1ccc(C#N)cc1.
What is the InChIKey of methyl N-(4-cyanophenyl)-N'-(4-methylphenyl)carbamimidothioate?
The InChIKey is LSMWFCZHYQTLBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3S/c1-12-3-7-14(8-4-12)18-16(20-2)19-15-9-5-13(11-17)6-10-15/h3-10H,1-2H3,(H,18,19).
What are the key properties of methyl N-(4-cyanophenyl)-N'-(4-methylphenyl)carbamimidothioate?
methyl N-(4-cyanophenyl)-N'-(4-methylphenyl)carbamimidothioate has a molecular weight of 281.38 g/mol, XLogP of 4.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(4-cyanophenyl)-N'-(4-methylphenyl)carbamimidothioate is sourced from PubChem (CID 19855134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).