About methyl N-(4-cyanophenyl)-N'-methylsulfonylcarbamimidothioate
methyl N-(4-cyanophenyl)-N'-methylsulfonylcarbamimidothioate (PubChem CID 19855123) has the molecular formula C10H11N3O2S2
and a molecular weight of 269.35 g/mol. Its IUPAC name is methyl N-(4-cyanophenyl)-N'-methylsulfonylcarbamimidothioate.
Molecular Properties
| Compound Name | methyl N-(4-cyanophenyl)-N'-methylsulfonylcarbamimidothioate |
| PubChem CID | 19855123 |
| Molecular Formula | C10H11N3O2S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | methyl N-(4-cyanophenyl)-N'-methylsulfonylcarbamimidothioate |
| SMILES | CS/C(=N/S(C)(=O)=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C10H11N3O2S2/c1-16-10(13-17(2,14)15)12-9-5-3-8(7-11)4-6-9/h3-6H,1-2H3,(H,12,13) |
| InChIKey | YLPSKZMRQOZRKR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 82.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(4-cyanophenyl)-N'-methylsulfonylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(4-cyanophenyl)-N'-methylsulfonylcarbamimidothioate?
The IUPAC name of methyl N-(4-cyanophenyl)-N'-methylsulfonylcarbamimidothioate (CID 19855123) is methyl N-(4-cyanophenyl)-N'-methylsulfonylcarbamimidothioate.
What is the SMILES notation for methyl N-(4-cyanophenyl)-N'-methylsulfonylcarbamimidothioate?
The canonical SMILES for methyl N-(4-cyanophenyl)-N'-methylsulfonylcarbamimidothioate is CS/C(=N/S(C)(=O)=O)Nc1ccc(C#N)cc1.
What is the InChIKey of methyl N-(4-cyanophenyl)-N'-methylsulfonylcarbamimidothioate?
The InChIKey is YLPSKZMRQOZRKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2S2/c1-16-10(13-17(2,14)15)12-9-5-3-8(7-11)4-6-9/h3-6H,1-2H3,(H,12,13).
What are the key properties of methyl N-(4-cyanophenyl)-N'-methylsulfonylcarbamimidothioate?
methyl N-(4-cyanophenyl)-N'-methylsulfonylcarbamimidothioate has a molecular weight of 269.35 g/mol, XLogP of 1.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(4-cyanophenyl)-N'-methylsulfonylcarbamimidothioate is sourced from PubChem (CID 19855123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).