C15H15N2Se — CID 6329260
Selenourea, N,N'-bis(4-methylphenyl)- (PubChem CID 6329260) has the molecular formula C15H15N2Se and a molecular weight of 302.26 g/mol.
| Compound Name | Selenourea, N,N'-bis(4-methylphenyl)- |
|---|---|
| PubChem CID | 6329260 |
| Molecular Formula | C15H15N2Se |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | — |
| SMILES | Cc1ccc(/N=C(\[Se])Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C15H15N2Se/c1-11-3-7-13(8-4-11)16-15(18)17-14-9-5-12(2)6-10-14/h3-10H,1-2H3,(H,16,17) |
| InChIKey | LONZZXNZUYYNLU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|