C19H25N2O3P — CID 15001480
1-diethoxyphosphoryl-N,N'-bis(4-methylphenyl)methanimidamide (PubChem CID 15001480) has the molecular formula C19H25N2O3P and a molecular weight of 360.39 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-N,N'-bis(4-methylphenyl)methanimidamide.
| Compound Name | 1-diethoxyphosphoryl-N,N'-bis(4-methylphenyl)methanimidamide |
|---|---|
| PubChem CID | 15001480 |
| Molecular Formula | C19H25N2O3P |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-diethoxyphosphoryl-N,N'-bis(4-methylphenyl)methanimidamide |
| SMILES | CCOP(=O)(OCC)/C(=N\c1ccc(C)cc1)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C19H25N2O3P/c1-5-23-25(22,24-6-2)19(20-17-11-7-15(3)8-12-17)21-18-13-9-16(4)10-14-18/h7-14H,5-6H2,1-4H3,(H,20,21) |
| InChIKey | DXWDYBOELIVONX-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|