C11H15FNO3PS — CID 138971382
1-diethoxyphosphoryl-N-(4-fluorophenyl)methanethioamide (PubChem CID 138971382) has the molecular formula C11H15FNO3PS and a molecular weight of 291.28 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-N-(4-fluorophenyl)methanethioamide.
| Compound Name | 1-diethoxyphosphoryl-N-(4-fluorophenyl)methanethioamide |
|---|---|
| PubChem CID | 138971382 |
| Molecular Formula | C11H15FNO3PS |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 1-diethoxyphosphoryl-N-(4-fluorophenyl)methanethioamide |
| SMILES | CCOP(=O)(OCC)C(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C11H15FNO3PS/c1-3-15-17(14,16-4-2)11(18)13-10-7-5-9(12)6-8-10/h5-8H,3-4H2,1-2H3,(H,13,18) |
| InChIKey | JBEQOZUNZDHJQD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|