C14H22ClN2O3PS — CID 11726317
1-(4-chlorophenyl)-3-(2-diethoxyphosphorylpropan-2-yl)thiourea (PubChem CID 11726317) has the molecular formula C14H22ClN2O3PS and a molecular weight of 364.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2-diethoxyphosphorylpropan-2-yl)thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-(2-diethoxyphosphorylpropan-2-yl)thiourea |
|---|---|
| PubChem CID | 11726317 |
| Molecular Formula | C14H22ClN2O3PS |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2-diethoxyphosphorylpropan-2-yl)thiourea |
| SMILES | CCOP(=O)(OCC)C(C)(C)NC(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H22ClN2O3PS/c1-5-19-21(18,20-6-2)14(3,4)17-13(22)16-12-9-7-11(15)8-10-12/h7-10H,5-6H2,1-4H3,(H2,16,17,22) |
| InChIKey | NAXCOUPCDWRREV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|