C14H22ClN2O4P — CID 10066373
1-(4-chlorophenyl)-3-(2-diethoxyphosphorylpropan-2-yl)urea (PubChem CID 10066373) has the molecular formula C14H22ClN2O4P and a molecular weight of 348.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2-diethoxyphosphorylpropan-2-yl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(2-diethoxyphosphorylpropan-2-yl)urea |
|---|---|
| PubChem CID | 10066373 |
| Molecular Formula | C14H22ClN2O4P |
| Molecular Weight | 348.77 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2-diethoxyphosphorylpropan-2-yl)urea |
| SMILES | CCOP(=O)(OCC)C(C)(C)NC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H22ClN2O4P/c1-5-20-22(19,21-6-2)14(3,4)17-13(18)16-12-9-7-11(15)8-10-12/h7-10H,5-6H2,1-4H3,(H2,16,17,18) |
| InChIKey | DSPHLSUIFOLHAX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.77 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|