C15H23Cl2N2O4P — CID 7241460
1-(3,5-dichlorophenyl)-3-[(2R)-2-diethoxyphosphorylbutan-2-yl]urea (PubChem CID 7241460) has the molecular formula C15H23Cl2N2O4P and a molecular weight of 397.24 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[(2R)-2-diethoxyphosphorylbutan-2-yl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[(2R)-2-diethoxyphosphorylbutan-2-yl]urea |
|---|---|
| PubChem CID | 7241460 |
| Molecular Formula | C15H23Cl2N2O4P |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[(2R)-2-diethoxyphosphorylbutan-2-yl]urea |
| SMILES | CCOP(=O)(OCC)[C@](C)(CC)NC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H23Cl2N2O4P/c1-5-15(4,24(21,22-6-2)23-7-3)19-14(20)18-13-9-11(16)8-12(17)10-13/h8-10H,5-7H2,1-4H3,(H2,18,19,20)/t15-/m1/s1 |
| InChIKey | JTTQLTRMPVXLNS-OAHLLOKOSA-N |
| XLogP | 5.51 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|