C12H17ClN2O2 — CID 94797935
1-(4-chlorophenyl)-3-[(2R)-2-hydroxy-2-methylbutyl]urea (PubChem CID 94797935) has the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(2R)-2-hydroxy-2-methylbutyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(2R)-2-hydroxy-2-methylbutyl]urea |
|---|---|
| PubChem CID | 94797935 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(2R)-2-hydroxy-2-methylbutyl]urea |
| SMILES | CC[C@@](C)(O)CNC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H17ClN2O2/c1-3-12(2,17)8-14-11(16)15-10-6-4-9(13)5-7-10/h4-7,17H,3,8H2,1-2H3,(H2,14,15,16)/t12-/m1/s1 |
| InChIKey | WETGKFTYVKCZKF-GFCCVEGCSA-N |
| XLogP | 2.62 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |