C16H26N2O4S — CID 56823994
1-(2-hydroxy-2-methylbutyl)-3-[4-(propan-2-ylsulfonylmethyl)phenyl]urea (PubChem CID 56823994) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is 1-(2-hydroxy-2-methylbutyl)-3-[4-(propan-2-ylsulfonylmethyl)phenyl]urea.
| Compound Name | 1-(2-hydroxy-2-methylbutyl)-3-[4-(propan-2-ylsulfonylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 56823994 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-(2-hydroxy-2-methylbutyl)-3-[4-(propan-2-ylsulfonylmethyl)phenyl]urea |
| SMILES | CCC(C)(O)CNC(=O)Nc1ccc(CS(=O)(=O)C(C)C)cc1 |
| InChI | InChI=1S/C16H26N2O4S/c1-5-16(4,20)11-17-15(19)18-14-8-6-13(7-9-14)10-23(21,22)12(2)3/h6-9,12,20H,5,10-11H2,1-4H3,(H2,17,18,19) |
| InChIKey | ISLJOPKYZKCVDW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |