C11H16ClN2O3PS — CID 14867421
1-(4-chlorophenyl)-3-diethoxyphosphorylthiourea (PubChem CID 14867421) has the molecular formula C11H16ClN2O3PS and a molecular weight of 322.75 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-diethoxyphosphorylthiourea.
| Compound Name | 1-(4-chlorophenyl)-3-diethoxyphosphorylthiourea |
|---|---|
| PubChem CID | 14867421 |
| Molecular Formula | C11H16ClN2O3PS |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 1-(4-chlorophenyl)-3-diethoxyphosphorylthiourea |
| SMILES | CCOP(=O)(NC(=S)Nc1ccc(Cl)cc1)OCC |
| InChI | InChI=1S/C11H16ClN2O3PS/c1-3-16-18(15,17-4-2)14-11(19)13-10-7-5-9(12)6-8-10/h5-8H,3-4H2,1-2H3,(H2,13,14,15,19) |
| InChIKey | VGPKDWWDLKEEKF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|