C19H21Cl2N4O3PS2 — CID 3998033
methyl 3-bis[(4-chlorophenyl)carbamothioylamino]phosphoryl-2-methylpropanoate (PubChem CID 3998033) has the molecular formula C19H21Cl2N4O3PS2 and a molecular weight of 519.42 g/mol. Its IUPAC name is methyl 3-bis[(4-chlorophenyl)carbamothioylamino]phosphoryl-2-methylpropanoate.
| Compound Name | methyl 3-bis[(4-chlorophenyl)carbamothioylamino]phosphoryl-2-methylpropanoate |
|---|---|
| PubChem CID | 3998033 |
| Molecular Formula | C19H21Cl2N4O3PS2 |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | methyl 3-bis[(4-chlorophenyl)carbamothioylamino]phosphoryl-2-methylpropanoate |
| SMILES | COC(=O)C(C)CP(=O)(NC(=S)Nc1ccc(Cl)cc1)NC(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21Cl2N4O3PS2/c1-12(17(26)28-2)11-29(27,24-18(30)22-15-7-3-13(20)4-8-15)25-19(31)23-16-9-5-14(21)6-10-16/h3-10,12H,11H2,1-2H3,(H4,22,23,24,25,27,30,31) |
| InChIKey | WIFPJVRIMDJSOP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|