C24H28ClNO4P2 — CID 135031831
(1S)-1-(4-chlorophenyl)-1-diethoxyphosphoryl-N-diphenylphosphorylethanamine (PubChem CID 135031831) has the molecular formula C24H28ClNO4P2 and a molecular weight of 491.89 g/mol. Its IUPAC name is (1S)-1-(4-chlorophenyl)-1-diethoxyphosphoryl-N-diphenylphosphorylethanamine.
| Compound Name | (1S)-1-(4-chlorophenyl)-1-diethoxyphosphoryl-N-diphenylphosphorylethanamine |
|---|---|
| PubChem CID | 135031831 |
| Molecular Formula | C24H28ClNO4P2 |
| Molecular Weight | 491.89 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | (1S)-1-(4-chlorophenyl)-1-diethoxyphosphoryl-N-diphenylphosphorylethanamine |
| SMILES | CCOP(=O)(OCC)[C@](C)(NP(=O)(c1ccccc1)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H28ClNO4P2/c1-4-29-32(28,30-5-2)24(3,20-16-18-21(25)19-17-20)26-31(27,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-19H,4-5H2,1-3H3,(H,26,27)/t24-/m0/s1 |
| InChIKey | SRMAOGURESHJQC-DEOSSOPVSA-N |
| XLogP | 6.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.89 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|