C25H23ClNO3P — CID 102494360
(2S)-2-[(1R)-1-(4-chlorophenyl)-1-(diphenylphosphorylamino)ethyl]-4-methyl-2H-furan-5-one (PubChem CID 102494360) has the molecular formula C25H23ClNO3P and a molecular weight of 451.89 g/mol. Its IUPAC name is (2S)-2-[(1R)-1-(4-chlorophenyl)-1-(diphenylphosphorylamino)ethyl]-4-methyl-2H-furan-5-one.
| Compound Name | (2S)-2-[(1R)-1-(4-chlorophenyl)-1-(diphenylphosphorylamino)ethyl]-4-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 102494360 |
| Molecular Formula | C25H23ClNO3P |
| Molecular Weight | 451.89 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | (2S)-2-[(1R)-1-(4-chlorophenyl)-1-(diphenylphosphorylamino)ethyl]-4-methyl-2H-furan-5-one |
| SMILES | CC1=C[C@@H]([C@](C)(NP(=O)(c2ccccc2)c2ccccc2)c2ccc(Cl)cc2)OC1=O |
| InChI | InChI=1S/C25H23ClNO3P/c1-18-17-23(30-24(18)28)25(2,19-13-15-20(26)16-14-19)27-31(29,21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-17,23H,1-2H3,(H,27,29)/t23-,25+/m0/s1 |
| InChIKey | HRCJQKVCARFKON-UKILVPOCSA-N |
| XLogP | 4.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.89 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|