C25H27ClNO3P — CID 102027658
ethyl (2S,3S)-3-(4-chlorophenyl)-3-(diphenylphosphorylamino)-2-methylbutanoate (PubChem CID 102027658) has the molecular formula C25H27ClNO3P and a molecular weight of 455.92 g/mol. Its IUPAC name is ethyl (2S,3S)-3-(4-chlorophenyl)-3-(diphenylphosphorylamino)-2-methylbutanoate.
| Compound Name | ethyl (2S,3S)-3-(4-chlorophenyl)-3-(diphenylphosphorylamino)-2-methylbutanoate |
|---|---|
| PubChem CID | 102027658 |
| Molecular Formula | C25H27ClNO3P |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | ethyl (2S,3S)-3-(4-chlorophenyl)-3-(diphenylphosphorylamino)-2-methylbutanoate |
| SMILES | CCOC(=O)[C@@H](C)[C@](C)(NP(=O)(c1ccccc1)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H27ClNO3P/c1-4-30-24(28)19(2)25(3,20-15-17-21(26)18-16-20)27-31(29,22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-19H,4H2,1-3H3,(H,27,29)/t19-,25+/m1/s1 |
| InChIKey | XEBDJVGRVSGLRE-CLOONOSVSA-N |
| XLogP | 5.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|