C24H28NO3P — CID 102204154
(4R,5S)-5-(diphenylphosphorylamino)-5-phenylhexane-1,4-diol (PubChem CID 102204154) has the molecular formula C24H28NO3P and a molecular weight of 409.47 g/mol. Its IUPAC name is (4R,5S)-5-(diphenylphosphorylamino)-5-phenylhexane-1,4-diol.
| Compound Name | (4R,5S)-5-(diphenylphosphorylamino)-5-phenylhexane-1,4-diol |
|---|---|
| PubChem CID | 102204154 |
| Molecular Formula | C24H28NO3P |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (4R,5S)-5-(diphenylphosphorylamino)-5-phenylhexane-1,4-diol |
| SMILES | C[C@](NP(=O)(c1ccccc1)c1ccccc1)(c1ccccc1)[C@H](O)CCCO |
| InChI | InChI=1S/C24H28NO3P/c1-24(23(27)18-11-19-26,20-12-5-2-6-13-20)25-29(28,21-14-7-3-8-15-21)22-16-9-4-10-17-22/h2-10,12-17,23,26-27H,11,18-19H2,1H3,(H,25,28)/t23-,24+/m1/s1 |
| InChIKey | ALWQFNYCPDUAEP-RPWUZVMVSA-N |
| XLogP | 3.55 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|