C43H42NO4PS — CID 102476646
N-diphenylphosphoryl-1-(4-methylphenyl)sulfonyl-5-trityloxypentan-1-amine (PubChem CID 102476646) has the molecular formula C43H42NO4PS and a molecular weight of 699.85 g/mol. Its IUPAC name is N-diphenylphosphoryl-1-(4-methylphenyl)sulfonyl-5-trityloxypentan-1-amine.
| Compound Name | N-diphenylphosphoryl-1-(4-methylphenyl)sulfonyl-5-trityloxypentan-1-amine |
|---|---|
| PubChem CID | 102476646 |
| Molecular Formula | C43H42NO4PS |
| Molecular Weight | 699.85 g/mol |
| Exact Mass | 699.26 |
| IUPAC Name | N-diphenylphosphoryl-1-(4-methylphenyl)sulfonyl-5-trityloxypentan-1-amine |
| SMILES | Cc1ccc(S(=O)(=O)C(CCCCOC(c2ccccc2)(c2ccccc2)c2ccccc2)NP(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C43H42NO4PS/c1-35-30-32-41(33-31-35)50(46,47)42(44-49(45,39-25-13-5-14-26-39)40-27-15-6-16-28-40)29-17-18-34-48-43(36-19-7-2-8-20-36,37-21-9-3-10-22-37)38-23-11-4-12-24-38/h2-16,19-28,30-33,42H,17-18,29,34H2,1H3,(H,44,45) |
| InChIKey | XBLWMNNBDMKBKU-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.85 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|