C25H28O3 — CID 100961940
(2S)-6-trityloxyhexane-1,2-diol (PubChem CID 100961940) has the molecular formula C25H28O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is (2S)-6-trityloxyhexane-1,2-diol.
| Compound Name | (2S)-6-trityloxyhexane-1,2-diol |
|---|---|
| PubChem CID | 100961940 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (2S)-6-trityloxyhexane-1,2-diol |
| SMILES | OC[C@@H](O)CCCCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28O3/c26-20-24(27)18-10-11-19-28-25(21-12-4-1-5-13-21,22-14-6-2-7-15-22)23-16-8-3-9-17-23/h1-9,12-17,24,26-27H,10-11,18-20H2/t24-/m0/s1 |
| InChIKey | PPTXAKOVZZSRES-DEOSSOPVSA-N |
| XLogP | 4.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|