C35H34NO2P — CID 23420726
2-(diphenylphosphorylamino)-1,1-bis(4-methylphenyl)-3-phenylpropan-1-ol (PubChem CID 23420726) has the molecular formula C35H34NO2P and a molecular weight of 531.64 g/mol. Its IUPAC name is 2-(diphenylphosphorylamino)-1,1-bis(4-methylphenyl)-3-phenylpropan-1-ol.
| Compound Name | 2-(diphenylphosphorylamino)-1,1-bis(4-methylphenyl)-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 23420726 |
| Molecular Formula | C35H34NO2P |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | 2-(diphenylphosphorylamino)-1,1-bis(4-methylphenyl)-3-phenylpropan-1-ol |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)C(Cc2ccccc2)NP(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H34NO2P/c1-27-18-22-30(23-19-27)35(37,31-24-20-28(2)21-25-31)34(26-29-12-6-3-7-13-29)36-39(38,32-14-8-4-9-15-32)33-16-10-5-11-17-33/h3-25,34,37H,26H2,1-2H3,(H,36,38) |
| InChIKey | TWMXGLBHTWSXTQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|