C30H31NO3S — CID 24799695
N-[(2S)-3-benzyl-3-hydroxy-1,4-diphenylbutan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 24799695) has the molecular formula C30H31NO3S and a molecular weight of 485.65 g/mol. Its IUPAC name is N-[(2S)-3-benzyl-3-hydroxy-1,4-diphenylbutan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S)-3-benzyl-3-hydroxy-1,4-diphenylbutan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 24799695 |
| Molecular Formula | C30H31NO3S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[(2S)-3-benzyl-3-hydroxy-1,4-diphenylbutan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccccc2)C(O)(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C30H31NO3S/c1-24-17-19-28(20-18-24)35(33,34)31-29(21-25-11-5-2-6-12-25)30(32,22-26-13-7-3-8-14-26)23-27-15-9-4-10-16-27/h2-20,29,31-32H,21-23H2,1H3/t29-/m0/s1 |
| InChIKey | HUPHRLVVZDIQCP-LJAQVGFWSA-N |
| XLogP | 5.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |