C19H25NO5S — CID 132548228
N-[(2R)-2-benzyl-2-hydroxy-3,3-dimethoxypropyl]-4-methylbenzenesulfonamide (PubChem CID 132548228) has the molecular formula C19H25NO5S and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[(2R)-2-benzyl-2-hydroxy-3,3-dimethoxypropyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2R)-2-benzyl-2-hydroxy-3,3-dimethoxypropyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 132548228 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[(2R)-2-benzyl-2-hydroxy-3,3-dimethoxypropyl]-4-methylbenzenesulfonamide |
| SMILES | COC(OC)[C@](O)(CNS(=O)(=O)c1ccc(C)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H25NO5S/c1-15-9-11-17(12-10-15)26(22,23)20-14-19(21,18(24-2)25-3)13-16-7-5-4-6-8-16/h4-12,18,20-21H,13-14H2,1-3H3/t19-/m1/s1 |
| InChIKey | KSWYBSIEOMCKFO-LJQANCHMSA-N |
| XLogP | 1.87 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|