C27H29NO6S — CID 138976216
dimethyl 2-benzyl-2-[[(4-methylphenyl)sulfonylamino]-phenylmethyl]butanedioate (PubChem CID 138976216) has the molecular formula C27H29NO6S and a molecular weight of 495.60 g/mol. Its IUPAC name is dimethyl 2-benzyl-2-[[(4-methylphenyl)sulfonylamino]-phenylmethyl]butanedioate.
| Compound Name | dimethyl 2-benzyl-2-[[(4-methylphenyl)sulfonylamino]-phenylmethyl]butanedioate |
|---|---|
| PubChem CID | 138976216 |
| Molecular Formula | C27H29NO6S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | dimethyl 2-benzyl-2-[[(4-methylphenyl)sulfonylamino]-phenylmethyl]butanedioate |
| SMILES | COC(=O)CC(Cc1ccccc1)(C(=O)OC)C(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H29NO6S/c1-20-14-16-23(17-15-20)35(31,32)28-25(22-12-8-5-9-13-22)27(26(30)34-3,19-24(29)33-2)18-21-10-6-4-7-11-21/h4-17,25,28H,18-19H2,1-3H3 |
| InChIKey | YMPDNMHVZOSERA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |