C31H32N2O4S — CID 78134123
ethyl 3-(benzenesulfonamido)-2-benzyl-2-(benzylamino)-3-phenylpropanoate (PubChem CID 78134123) has the molecular formula C31H32N2O4S and a molecular weight of 528.67 g/mol. Its IUPAC name is ethyl 3-(benzenesulfonamido)-2-benzyl-2-(benzylamino)-3-phenylpropanoate.
| Compound Name | ethyl 3-(benzenesulfonamido)-2-benzyl-2-(benzylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 78134123 |
| Molecular Formula | C31H32N2O4S |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | ethyl 3-(benzenesulfonamido)-2-benzyl-2-(benzylamino)-3-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)(NCc1ccccc1)C(NS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H32N2O4S/c1-2-37-30(34)31(23-25-15-7-3-8-16-25,32-24-26-17-9-4-10-18-26)29(27-19-11-5-12-20-27)33-38(35,36)28-21-13-6-14-22-28/h3-22,29,32-33H,2,23-24H2,1H3 |
| InChIKey | HOMZOGKAZYFKFT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |