C14H12Cl3NO2S — CID 11760285
N-(2,2,2-trichloro-1-phenylethyl)benzenesulfonamide (PubChem CID 11760285) has the molecular formula C14H12Cl3NO2S and a molecular weight of 364.68 g/mol. Its IUPAC name is N-(2,2,2-trichloro-1-phenylethyl)benzenesulfonamide.
| Compound Name | N-(2,2,2-trichloro-1-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11760285 |
| Molecular Formula | C14H12Cl3NO2S |
| Molecular Weight | 364.68 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | N-(2,2,2-trichloro-1-phenylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NC(c1ccccc1)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C14H12Cl3NO2S/c15-14(16,17)13(11-7-3-1-4-8-11)18-21(19,20)12-9-5-2-6-10-12/h1-10,13,18H |
| InChIKey | UTLMHXAIJAYMIZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.68 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|