C14H11Cl3INO2S — CID 1037783
N-[(1S)-2,2,2-trichloro-1-(4-iodophenyl)ethyl]benzenesulfonamide (PubChem CID 1037783) has the molecular formula C14H11Cl3INO2S and a molecular weight of 490.58 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-(4-iodophenyl)ethyl]benzenesulfonamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-(4-iodophenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1037783 |
| Molecular Formula | C14H11Cl3INO2S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 488.86 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-(4-iodophenyl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H](c1ccc(I)cc1)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C14H11Cl3INO2S/c15-14(16,17)13(10-6-8-11(18)9-7-10)19-22(20,21)12-4-2-1-3-5-12/h1-9,13,19H/t13-/m0/s1 |
| InChIKey | ONULXHJEMLLRKJ-ZDUSSCGKSA-N |
| XLogP | 4.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|