C34H29N3O2S — CID 134972774
N-[(1S,2R)-2-(benzhydrylamino)-2-cyano-1,2-diphenylethyl]benzenesulfonamide (PubChem CID 134972774) has the molecular formula C34H29N3O2S and a molecular weight of 543.69 g/mol. Its IUPAC name is N-[(1S,2R)-2-(benzhydrylamino)-2-cyano-1,2-diphenylethyl]benzenesulfonamide.
| Compound Name | N-[(1S,2R)-2-(benzhydrylamino)-2-cyano-1,2-diphenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134972774 |
| Molecular Formula | C34H29N3O2S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | N-[(1S,2R)-2-(benzhydrylamino)-2-cyano-1,2-diphenylethyl]benzenesulfonamide |
| SMILES | N#C[C@@](NC(c1ccccc1)c1ccccc1)(c1ccccc1)[C@@H](NS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H29N3O2S/c35-26-34(30-22-12-4-13-23-30,36-32(27-16-6-1-7-17-27)28-18-8-2-9-19-28)33(29-20-10-3-11-21-29)37-40(38,39)31-24-14-5-15-25-31/h1-25,32-33,36-37H/t33-,34+/m0/s1 |
| InChIKey | CNAYEBVNORZREX-SZAHLOSFSA-N |
| XLogP | 6.50 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |