C18H18Cl3NO5S — CID 1117502
methyl 2-[4-[(1R)-1-(benzenesulfonamido)-2,2,2-trichloroethyl]-2-methylphenoxy]acetate (PubChem CID 1117502) has the molecular formula C18H18Cl3NO5S and a molecular weight of 466.77 g/mol. Its IUPAC name is methyl 2-[4-[(1R)-1-(benzenesulfonamido)-2,2,2-trichloroethyl]-2-methylphenoxy]acetate.
| Compound Name | methyl 2-[4-[(1R)-1-(benzenesulfonamido)-2,2,2-trichloroethyl]-2-methylphenoxy]acetate |
|---|---|
| PubChem CID | 1117502 |
| Molecular Formula | C18H18Cl3NO5S |
| Molecular Weight | 466.77 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | methyl 2-[4-[(1R)-1-(benzenesulfonamido)-2,2,2-trichloroethyl]-2-methylphenoxy]acetate |
| SMILES | COC(=O)COc1ccc([C@@H](NS(=O)(=O)c2ccccc2)C(Cl)(Cl)Cl)cc1C |
| InChI | InChI=1S/C18H18Cl3NO5S/c1-12-10-13(8-9-15(12)27-11-16(23)26-2)17(18(19,20)21)22-28(24,25)14-6-4-3-5-7-14/h3-10,17,22H,11H2,1-2H3/t17-/m1/s1 |
| InChIKey | RWDCJILUODFFSB-QGZVFWFLSA-N |
| XLogP | 3.94 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.77 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|