C17H15Cl3N2O2S — CID 594210
N-[2,2,2-trichloro-1-(2-methyl-1H-indol-3-yl)ethyl]benzenesulfonamide (PubChem CID 594210) has the molecular formula C17H15Cl3N2O2S and a molecular weight of 417.75 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(2-methyl-1H-indol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | N-[2,2,2-trichloro-1-(2-methyl-1H-indol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 594210 |
| Molecular Formula | C17H15Cl3N2O2S |
| Molecular Weight | 417.75 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | N-[2,2,2-trichloro-1-(2-methyl-1H-indol-3-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1[nH]c2ccccc2c1C(NS(=O)(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H15Cl3N2O2S/c1-11-15(13-9-5-6-10-14(13)21-11)16(17(18,19)20)22-25(23,24)12-7-3-2-4-8-12/h2-10,16,21-22H,1H3 |
| InChIKey | DQHOILISLFJVTD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.75 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|