C23H20ClNO2S — CID 56954897
3-[(4-chlorophenyl)-(4-methylphenyl)sulfonylmethyl]-2-methyl-1H-indole (PubChem CID 56954897) has the molecular formula C23H20ClNO2S and a molecular weight of 409.94 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)-(4-methylphenyl)sulfonylmethyl]-2-methyl-1H-indole.
| Compound Name | 3-[(4-chlorophenyl)-(4-methylphenyl)sulfonylmethyl]-2-methyl-1H-indole |
|---|---|
| PubChem CID | 56954897 |
| Molecular Formula | C23H20ClNO2S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 3-[(4-chlorophenyl)-(4-methylphenyl)sulfonylmethyl]-2-methyl-1H-indole |
| SMILES | Cc1ccc(S(=O)(=O)C(c2ccc(Cl)cc2)c2c(C)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C23H20ClNO2S/c1-15-7-13-19(14-8-15)28(26,27)23(17-9-11-18(24)12-10-17)22-16(2)25-21-6-4-3-5-20(21)22/h3-14,23,25H,1-2H3 |
| InChIKey | LRJVECJNMXNAAJ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|