C14H20N2 — CID 131384165
(1S)-2,2-dimethyl-1-(2-methyl-1H-indol-3-yl)propan-1-amine (PubChem CID 131384165) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (1S)-2,2-dimethyl-1-(2-methyl-1H-indol-3-yl)propan-1-amine.
| Compound Name | (1S)-2,2-dimethyl-1-(2-methyl-1H-indol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 131384165 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (1S)-2,2-dimethyl-1-(2-methyl-1H-indol-3-yl)propan-1-amine |
| SMILES | Cc1[nH]c2ccccc2c1[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C14H20N2/c1-9-12(13(15)14(2,3)4)10-7-5-6-8-11(10)16-9/h5-8,13,16H,15H2,1-4H3/t13-/m1/s1 |
| InChIKey | VIHAMIQXWAPZOK-CYBMUJFWSA-N |
| XLogP | 3.52 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|