C11H15N3 — CID 131198811
(1S)-1-(2-methyl-1H-indol-3-yl)ethane-1,2-diamine (PubChem CID 131198811) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is (1S)-1-(2-methyl-1H-indol-3-yl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(2-methyl-1H-indol-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 131198811 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (1S)-1-(2-methyl-1H-indol-3-yl)ethane-1,2-diamine |
| SMILES | Cc1[nH]c2ccccc2c1[C@H](N)CN |
| InChI | InChI=1S/C11H15N3/c1-7-11(9(13)6-12)8-4-2-3-5-10(8)14-7/h2-5,9,14H,6,12-13H2,1H3/t9-/m1/s1 |
| InChIKey | VTOGUIVCBBKPOJ-SECBINFHSA-N |
| XLogP | 1.43 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|