C14H18N2 — CID 171206860
(1R)-1-(2-methyl-1H-indol-3-yl)pent-4-en-1-amine (PubChem CID 171206860) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (1R)-1-(2-methyl-1H-indol-3-yl)pent-4-en-1-amine.
| Compound Name | (1R)-1-(2-methyl-1H-indol-3-yl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 171206860 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | (1R)-1-(2-methyl-1H-indol-3-yl)pent-4-en-1-amine |
| SMILES | C=CCC[C@@H](N)c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C14H18N2/c1-3-4-8-12(15)14-10(2)16-13-9-6-5-7-11(13)14/h3,5-7,9,12,16H,1,4,8,15H2,2H3/t12-/m1/s1 |
| InChIKey | FXDXVAWPYZDPER-GFCCVEGCSA-N |
| XLogP | 3.44 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|