C11H11F3N2 — CID 95447779
(1R)-2,2,2-trifluoro-1-(2-methyl-1H-indol-3-yl)ethanamine (PubChem CID 95447779) has the molecular formula C11H11F3N2 and a molecular weight of 228.22 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(2-methyl-1H-indol-3-yl)ethanamine.
| Compound Name | (1R)-2,2,2-trifluoro-1-(2-methyl-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 95447779 |
| Molecular Formula | C11H11F3N2 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(2-methyl-1H-indol-3-yl)ethanamine |
| SMILES | Cc1[nH]c2ccccc2c1[C@@H](N)C(F)(F)F |
| InChI | InChI=1S/C11H11F3N2/c1-6-9(10(15)11(12,13)14)7-4-2-3-5-8(7)16-6/h2-5,10,16H,15H2,1H3/t10-/m1/s1 |
| InChIKey | KRNPFQCSJGJCNF-SNVBAGLBSA-N |
| XLogP | 3.04 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|