C12H14ClF3N2 — CID 171206848
(1R)-3,3,3-trifluoro-1-(2-methyl-1H-indol-3-yl)propan-1-amine;hydrochloride (PubChem CID 171206848) has the molecular formula C12H14ClF3N2 and a molecular weight of 278.70 g/mol. Its IUPAC name is (1R)-3,3,3-trifluoro-1-(2-methyl-1H-indol-3-yl)propan-1-amine;hydrochloride.
| Compound Name | (1R)-3,3,3-trifluoro-1-(2-methyl-1H-indol-3-yl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171206848 |
| Molecular Formula | C12H14ClF3N2 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (1R)-3,3,3-trifluoro-1-(2-methyl-1H-indol-3-yl)propan-1-amine;hydrochloride |
| SMILES | Cc1[nH]c2ccccc2c1[C@H](N)CC(F)(F)F.Cl |
| InChI | InChI=1S/C12H13F3N2.ClH/c1-7-11(9(16)6-12(13,14)15)8-4-2-3-5-10(8)17-7;/h2-5,9,17H,6,16H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | NHZDQUUYJHELIC-SBSPUUFOSA-N |
| XLogP | 3.85 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|